Basic Copper Carbonate thermal decomposition, preparation, solubility, reaction with acid, chemical formula and other issues are frequently asked by everyone, and it is also the basic knowledge that many friends in the industry need to understand. The relevant questions and answers of basic copper carbonate are summarized as follows, I hope it can be helpful to you.

  1. What does it decompose into when heated?
    It decomposes into water, copper oxide and carbon dioxide when heated. The reaction equation is as follows: Cu2(OH)2CO3→2CuO+CO2+H2O
  2. What is the preparation method?
    Prepared by the reaction of copper sulfate, sodium carbonate and water. 2CuSO 4+2Na2CO 3+H2O ═Cu2(OH) 2CO 3↓+2Na2SO 4+CO 2↑. There are many industrial production methods, and the raw materials required for each production method are different, and the quality of the finished products is also quite different.
  3. React with various acids?
    It reacts with H2SO4 to produce copper sulfate, and reacts with HCL to produce copper chloride. Cu2(OH)2CO3+2H2SO4=2CuSO4+2H2O+CO2↑+H2O; 4HCl+Cu2(OH)2CO3=2CuCl2+2H2O+CO2↑
  4. How to write chemical formula?
    Cu2(OH)2CO3, the decomposition temperature is 200 degrees
  5. What is the solubility?
    The solubility of Basic Copper Chloride in water is very small, the dissolved grams per 100 ml of water at 20°C: 1.462×10-4g/100ml